EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H46O2 |
| Net Charge | 0 |
| Average Mass | 354.619 |
| Monoisotopic Mass | 354.34978 |
| SMILES | CCC(C)CCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C23H46O2/c1-3-22(2)20-18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19-21-23(24)25/h22H,3-21H2,1-2H3,(H,24,25) |
| InChIKey | MZRXKFZYUOFQRH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-methyldocosanoic acid (CHEBI:84878) has functional parent docosanoic acid (CHEBI:28941) |
| 20-methyldocosanoic acid (CHEBI:84878) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 20-methyldocosanoic acid (CHEBI:84878) is a long-chain fatty acid (CHEBI:15904) |
| 20-methyldocosanoic acid (CHEBI:84878) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 20-methyldocosanoic acid |
| Synonym | Source |
|---|---|
| 20-methylbehenic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727734 | Reaxys |