EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H42O2 |
| Net Charge | 0 |
| Average Mass | 326.565 |
| Monoisotopic Mass | 326.31848 |
| SMILES | CCC(C)CCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C21H42O2/c1-3-20(2)18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19-21(22)23/h20H,3-19H2,1-2H3,(H,22,23) |
| InChIKey | WSRCOZWDQPJAQT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-methylicosanoic acid (CHEBI:84877) has functional parent icosanoic acid (CHEBI:28822) |
| 18-methylicosanoic acid (CHEBI:84877) has role mammalian metabolite (CHEBI:75768) |
| 18-methylicosanoic acid (CHEBI:84877) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 18-methylicosanoic acid (CHEBI:84877) is a long-chain fatty acid (CHEBI:15904) |
| 18-methylicosanoic acid (CHEBI:84877) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 18-methylicosanoic acid |
| Synonyms | Source |
|---|---|
| 18-methylarachidic acid | ChEBI |
| 18-methyleicosanoic acid | ChEBI |
| Anteisoheneicosanoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020018 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726967 | Reaxys |
| CAS:36332-93-1 | ChemIDplus |
| Citations |
|---|