EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34O2 |
| Net Charge | 0 |
| Average Mass | 270.457 |
| Monoisotopic Mass | 270.25588 |
| SMILES | CCC(C)CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H34O2/c1-3-16(2)14-12-10-8-6-4-5-7-9-11-13-15-17(18)19/h16H,3-15H2,1-2H3,(H,18,19) |
| InChIKey | FXUKWLSZZHVEJD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cervus nippon (ncbitaxon:9863) | - | PubMed (15112737) | Found in the preorbital glands |
| Pinus contorta (ncbitaxon:3339) | seed (BTO:0001226) | PubMed (9307939) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-methylhexadecanoic acid (CHEBI:84874) has functional parent hexadecanoic acid (CHEBI:15756) |
| 14-methylhexadecanoic acid (CHEBI:84874) has role mammalian metabolite (CHEBI:75768) |
| 14-methylhexadecanoic acid (CHEBI:84874) has role plant metabolite (CHEBI:76924) |
| 14-methylhexadecanoic acid (CHEBI:84874) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 14-methylhexadecanoic acid (CHEBI:84874) is a long-chain fatty acid (CHEBI:15904) |
| 14-methylhexadecanoic acid (CHEBI:84874) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 14-methylhexadecanoic acid |
| Synonym | Source |
|---|---|
| 14-methylpalmitic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020011 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724926 | Reaxys |
| CAS:5918-29-6 | ChemIDplus |
| Citations |
|---|