EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O2 |
| Net Charge | 0 |
| Average Mass | 332.528 |
| Monoisotopic Mass | 332.27153 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCC |
| InChI | InChI=1S/C22H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24-4-2/h8-9,11-12,14-15,17-18H,3-7,10,13,16,19-21H2,1-2H3/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | SNXPWYFWAZVIAU-GKFVBPDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12784867) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl arachidonate (CHEBI:84873) has functional parent arachidonic acid (CHEBI:15843) |
| ethyl arachidonate (CHEBI:84873) has role human blood serum metabolite (CHEBI:85234) |
| ethyl arachidonate (CHEBI:84873) has role human xenobiotic metabolite (CHEBI:76967) |
| ethyl arachidonate (CHEBI:84873) is a long-chain fatty acid ethyl ester (CHEBI:13209) |
| IUPAC Name |
|---|
| ethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| Synonyms | Source |
|---|---|
| Arachidonic acid, ethyl ester | ChemIDplus |
| ethyl (5Z,8Z,11Z,14Z)-eicosa-5,8,11,14-tetraenoate | ChEBI |
| ethyl (5Z,8Z,11Z,14Z)-eicosatetraenoate | ChEBI |
| ethyl (5Z,8Z,11Z,14Z)-icosatetraenoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1914615 | Reaxys |
| CAS:1808-26-0 | ChemIDplus |
| Citations |
|---|