EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H26O2 |
| Net Charge | 0 |
| Average Mass | 214.349 |
| Monoisotopic Mass | 214.19328 |
| SMILES | CCC(C)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C13H26O2/c1-3-12(2)10-8-6-4-5-7-9-11-13(14)15/h12H,3-11H2,1-2H3,(H,14,15) |
| InChIKey | YETWOCQNUTWSQA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-methyldodecanoic acid (CHEBI:84872) has functional parent dodecanoic acid (CHEBI:30805) |
| 10-methyldodecanoic acid (CHEBI:84872) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 10-methyldodecanoic acid (CHEBI:84872) is a medium-chain fatty acid (CHEBI:59554) |
| 10-methyldodecanoic acid (CHEBI:84872) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 10-methyldodecanoic acid |
| Synonym | Source |
|---|---|
| 10-methyllauric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020005 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722999 | Reaxys |
| CAS:7416-57-1 | ChemIDplus |