EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H58O2 |
| Net Charge | 0 |
| Average Mass | 438.781 |
| Monoisotopic Mass | 438.44368 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C29H58O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29(30)31/h2-28H2,1H3,(H,30,31) |
| InChIKey | IHEJEKZAKSNRLY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Butea monosperma (ncbitaxon:56060) | stem (BTO:0001300) | PubMed (11014275) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonacosanoic acid (CHEBI:84867) has role plant metabolite (CHEBI:76924) |
| nonacosanoic acid (CHEBI:84867) is a prostaglandin A1 (CHEBI:15545) |
| nonacosanoic acid (CHEBI:84867) is a straight-chain saturated fatty acid (CHEBI:39418) |
| Incoming Relation(s) |
| 28-methylnonacosanoic acid (CHEBI:84908) has functional parent nonacosanoic acid (CHEBI:84867) |
| ω-hydroxynonacosanoic acid (CHEBI:84865) has functional parent nonacosanoic acid (CHEBI:84867) |
| IUPAC Name |
|---|
| nonacosanoic acid |
| Synonym | Source |
|---|---|
| nonacosylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00037560 | KNApSAcK |
| CPD-8510 | MetaCyc |
| HMDB0002230 | HMDB |
| LMFA01010029 | LIPID MAPS |
| Nonacosylic_acid | Wikipedia |
| Citations |
|---|