EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H56O3 |
| Net Charge | 0 |
| Average Mass | 440.753 |
| Monoisotopic Mass | 440.42295 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C28H56O3/c29-27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26-28(30)31/h29H,1-27H2,(H,30,31) |
| InChIKey | DQDKWDYKDPDWMY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ω-hydroxyoctacosanoic acid (CHEBI:84863) has functional parent octacosanoic acid (CHEBI:31001) |
| ω-hydroxyoctacosanoic acid (CHEBI:84863) is a ω-hydroxy-ultra-long-chain fatty acid (CHEBI:147297) |
| IUPAC Name |
|---|
| 28-hydroxyoctacosanoic acid |
| Synonyms | Source |
|---|---|
| 28-hydroxymontanic acid | ChEBI |
| ω-hydroxymontanic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050220 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1915327 | Reaxys |