EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H50O3 |
| Net Charge | 0 |
| Average Mass | 398.672 |
| Monoisotopic Mass | 398.37600 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C25H50O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(26)25(27)28/h24,26H,2-23H2,1H3,(H,27,28) |
| InChIKey | CUSDWPFQTXVFJL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxypentacosanoic acid (CHEBI:84860) has functional parent pentacosanoic acid (CHEBI:39420) |
| 2-hydroxypentacosanoic acid (CHEBI:84860) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxypentacosanoic acid (CHEBI:84860) is a very long-chain fatty acid anion (CHEBI:58950) |
| 2-hydroxypentacosanoic acid (CHEBI:84860) is conjugate acid of 2-hydroxypentacosanoate (CHEBI:84378) |
| Incoming Relation(s) |
| 2-hydroxypentacosanoate (CHEBI:84378) is conjugate base of 2-hydroxypentacosanoic acid (CHEBI:84860) |
| IUPAC Name |
|---|
| 2-hydroxypentacosanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-8474 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1801716 | Reaxys |
| CAS:58394-60-8 | ChemIDplus |
| Citations |
|---|