EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H46O3 |
| Net Charge | 0 |
| Average Mass | 370.618 |
| Monoisotopic Mass | 370.34470 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C23H46O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(24)23(25)26/h22,24H,2-21H2,1H3,(H,25,26) |
| InChIKey | JZWLIRVAYJRWLN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxytricosanoic acid (CHEBI:84858) has functional parent tricosanoic acid (CHEBI:42394) |
| 2-hydroxytricosanoic acid (CHEBI:84858) has role animal metabolite (CHEBI:75767) |
| 2-hydroxytricosanoic acid (CHEBI:84858) has role marine metabolite (CHEBI:76507) |
| 2-hydroxytricosanoic acid (CHEBI:84858) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxytricosanoic acid (CHEBI:84858) is conjugate acid of 2-hydroxytricosanoate (CHEBI:84316) |
| Incoming Relation(s) |
| 2-hydroxytricosanoate (CHEBI:84316) is conjugate base of 2-hydroxytricosanoic acid (CHEBI:84858) |
| IUPAC Name |
|---|
| 2-hydroxytricosanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050212 | LIPID MAPS |
| CPD-8470 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8169249 | Reaxys |
| CAS:26632-12-2 | ChemIDplus |
| Citations |
|---|