EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O3 |
| Net Charge | 0 |
| Average Mass | 258.402 |
| Monoisotopic Mass | 258.21949 |
| SMILES | CCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C15H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(16)15(17)18/h14,16H,2-13H2,1H3,(H,17,18) |
| InChIKey | NKASEPJANRVKDD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lentinula edodes (ncbitaxon:5353) | - | PubMed (15055237) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxypentadecanoic acid (CHEBI:84853) has functional parent pentadecanoic acid (CHEBI:42504) |
| 2-hydroxypentadecanoic acid (CHEBI:84853) has role fungal metabolite (CHEBI:76946) |
| 2-hydroxypentadecanoic acid (CHEBI:84853) is a 2-hydroxy fatty acid (CHEBI:10283) |
| IUPAC Name |
|---|
| 2-hydroxypentadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-8473 | MetaCyc |
| LMFA01050045 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725744 | Reaxys |
| CAS:2507-54-2 | ChemIDplus |
| Citations |
|---|