EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2O3 |
| Net Charge | 0 |
| Average Mass | 294.395 |
| Monoisotopic Mass | 294.19434 |
| SMILES | CCCOc1ccc(C(=O)OCCN(CC)CC)cc1N |
| InChI | InChI=1S/C16H26N2O3/c1-4-10-20-15-8-7-13(12-14(15)17)16(19)21-11-9-18(5-2)6-3/h7-8,12H,4-6,9-11,17H2,1-3H3 |
| InChIKey | KCLANYCVBBTKTO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Application: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Proparacaine (CHEBI:8485) has role analgesic (CHEBI:35480) |
| Proparacaine (CHEBI:8485) is a benzoate ester (CHEBI:36054) |
| INN | Source |
|---|---|
| proximetacaina | WHO MedNet |
| Synonyms | Source |
|---|---|
| ophthaine | DrugCentral |
| Proparacaine | KEGG COMPOUND |
| proparacaine HCl | DrugCentral |
| proparacaine hydrochloride | DrugCentral |
| Proxymetacaine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2294 | DrugCentral |
| C07383 | KEGG COMPOUND |
| D08448 | KEGG DRUG |
| HMDB0014945 | HMDB |
| LSM-3780 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:499-67-2 | KEGG COMPOUND |
| Citations |
|---|