EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C23H30NO3 |
| Net Charge | 0 |
| Average Mass | 448.401 |
| Monoisotopic Mass | 447.14091 |
| SMILES | CC(C)[N+](C)(CCOC(=O)C1c2ccccc2Oc2ccccc21)C(C)C.[Br-] |
| InChI | InChI=1S/C23H30NO3.BrH/c1-16(2)24(5,17(3)4)14-15-26-23(25)22-18-10-6-8-12-20(18)27-21-13-9-7-11-19(21)22;/h6-13,16-17,22H,14-15H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | XLBIBBZXLMYSFF-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Propantheline bromide (CHEBI:8482) has role anti-ulcer drug (CHEBI:49201) |
| Propantheline bromide (CHEBI:8482) is a xanthenes (CHEBI:38835) |
| INNs | Source |
|---|---|
| bromure de propantheline | WHO MedNet |
| bromuro de propantelina | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-757294 | ChEMBL |
| Probanthine | KEGG COMPOUND |
| Pro-Banthine (TN) | KEGG COMPOUND |
| Propantheline bromide | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Pro-banthine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00481 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:50-34-0 | KEGG COMPOUND |
| Citations |
|---|