EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO8S |
| Net Charge | 0 |
| Average Mass | 259.236 |
| Monoisotopic Mass | 259.03619 |
| SMILES | N[C@H]1C(O)O[C@H](COS(=O)(=O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO8S/c7-3-5(9)4(8)2(15-6(3)10)1-14-16(11,12)13/h2-6,8-10H,1,7H2,(H,11,12,13)/t2-,3-,4-,5-,6?/m1/s1 |
| InChIKey | MTDHILKWIRSIHB-IVMDWMLBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-O-sulfo-D-glucosamine (CHEBI:84776) is a amino monosaccharide (CHEBI:60926) |
| 6-O-sulfo-D-glucosamine (CHEBI:84776) is a glucosamine sulfate (CHEBI:37878) |
| 6-O-sulfo-D-glucosamine (CHEBI:84776) is conjugate acid of 6-O-sulfonato-D-glucosamine (CHEBI:84777) |
| Incoming Relation(s) |
| β-D-glucosamine 6-sulfate (CHEBI:133343) is a 6-O-sulfo-D-glucosamine (CHEBI:84776) |
| 6-O-sulfonato-D-glucosamine (CHEBI:84777) is conjugate base of 6-O-sulfo-D-glucosamine (CHEBI:84776) |
| IUPAC Name |
|---|
| 2-amino-2-deoxy-6-O-sulfo-D-glucopyranose |
| Synonym | Source |
|---|---|
| 2-amino-2-deoxy-D-glucopyranose 6-(hydrogen sulfate) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7413531 | Reaxys |
| Citations |
|---|