EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO7 |
| Net Charge | 0 |
| Average Mass | 251.235 |
| Monoisotopic Mass | 251.10050 |
| SMILES | NCCCO[C@@H]1O[C@H](C(=O)O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H17NO7/c10-2-1-3-16-9-6(13)4(11)5(12)7(17-9)8(14)15/h4-7,9,11-13H,1-3,10H2,(H,14,15)/t4-,5+,6+,7-,9+/m0/s1 |
| InChIKey | GDHKPCYWNVPHIH-SDBNBOCMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-aminopropyl β-D-galactopyranosiduronic acid (CHEBI:84769) is a galactosiduronic acid (CHEBI:24177) |
| 3-aminopropyl β-D-galactopyranosiduronic acid (CHEBI:84769) is conjugate acid of 3-aminopropyl β-D-galactopyranosiduronate (CHEBI:84770) |
| Incoming Relation(s) |
| 3-aminopropyl β-D-galactopyranosiduronate (CHEBI:84770) is conjugate base of 3-aminopropyl β-D-galactopyranosiduronic acid (CHEBI:84769) |
| IUPAC Name |
|---|
| 3-aminopropyl β-D-galactopyranosiduronic acid |
| Citations |
|---|