EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22N2O9S |
| Net Charge | 0 |
| Average Mass | 358.369 |
| Monoisotopic Mass | 358.10460 |
| SMILES | CC(=O)N[C@H]1[C@H](OCCCN)O[C@H](COS(=O)(=O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H22N2O9S/c1-6(14)13-8-10(16)9(15)7(5-21-23(17,18)19)22-11(8)20-4-2-3-12/h7-11,15-16H,2-5,12H2,1H3,(H,13,14)(H,17,18,19)/t7-,8-,9-,10-,11-/m1/s1 |
| InChIKey | NKBMTWFJKBBURQ-ISUQUUIWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-aminopropyl N-acetyl-6-O-sulfo-β-D-glucosaminide (CHEBI:84767) has functional parent D-glucosamine (CHEBI:17315) |
| 3-aminopropyl N-acetyl-6-O-sulfo-β-D-glucosaminide (CHEBI:84767) is a glycoside (CHEBI:24400) |
| 3-aminopropyl N-acetyl-6-O-sulfo-β-D-glucosaminide (CHEBI:84767) is a monosaccharide sulfate (CHEBI:24589) |
| 3-aminopropyl N-acetyl-6-O-sulfo-β-D-glucosaminide (CHEBI:84767) is conjugate acid of 3-aminopropyl N-acetyl-6-O-sulfonato-β-D-glucosaminide (CHEBI:84768) |
| Incoming Relation(s) |
| 3-aminopropyl N-acetyl-6-O-sulfonato-β-D-glucosaminide (CHEBI:84768) is conjugate base of 3-aminopropyl N-acetyl-6-O-sulfo-β-D-glucosaminide (CHEBI:84767) |
| IUPAC Name |
|---|
| 3-aminopropyl 2-acetamido-2-deoxy-6-O-sulfo-β-D-glucopyranoside |
| Citations |
|---|