EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N4O6 |
| Net Charge | 0 |
| Average Mass | 344.368 |
| Monoisotopic Mass | 344.16958 |
| SMILES | CC(=O)N(O)CCC[C@@H]1NC(=O)[C@H](CCCN(O)C(C)=O)NC1=O |
| InChI | InChI=1S/C14H24N4O6/c1-9(19)17(23)7-3-5-11-13(21)16-12(14(22)15-11)6-4-8-18(24)10(2)20/h11-12,23-24H,3-8H2,1-2H3,(H,15,22)(H,16,21)/t11-,12-/m0/s1 |
| InChIKey | PUWVNTVQJFSBDH-RYUDHWBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodotorula mucilaginosa (ncbitaxon:5537) | - | PubMed (23490182) | Strain: LM9 |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhodotorulic acid (CHEBI:84731) has role fungal metabolite (CHEBI:76946) |
| rhodotorulic acid (CHEBI:84731) has role siderophore (CHEBI:26672) |
| rhodotorulic acid (CHEBI:84731) is a L-ornithine derivative (CHEBI:21368) |
| rhodotorulic acid (CHEBI:84731) is a 2,5-diketopiperazines (CHEBI:65061) |
| rhodotorulic acid (CHEBI:84731) is a hydroxamic acid (CHEBI:24650) |
| IUPAC Name |
|---|
| N,N'-{[(2S,5S)-3,6-dioxopiperazine-2,5-diyl]dipropane-3,1-diyl}bis(N-hydroxyacetamide) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:965705 | Reaxys |
| CAS:18928-00-2 | ChemIDplus |
| Citations |
|---|