EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36N4O20P2 |
| Net Charge | 0 |
| Average Mass | 750.497 |
| Monoisotopic Mass | 750.13981 |
| SMILES | CC(=O)N[C@H]1[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3ccc(=O)nc3=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H](C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C23H36N4O20P2/c1-8(21(35)36)24-19(34)9(2)43-18-14(25-10(3)29)22(45-11(6-28)16(18)32)46-49(40,41)47-48(38,39)42-7-12-15(31)17(33)20(44-12)27-5-4-13(30)26-23(27)37/h4-5,8-9,11-12,14-18,20,22,28,31-33H,6-7H2,1-3H3,(H,24,34)(H,25,29)(H,35,36)(H,38,39)(H,40,41)(H,26,30,37)/t8-,9+,11+,12+,14+,15+,16+,17+,18+,20+,22+/m0/s1 |
| InChIKey | NTMMCWJNQNKACG-KBKUWGQMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-N-acetyl-α-D-muramoyl-L-alanine (CHEBI:84726) is a UDP-N-acetylmuramoyl-L-alanine (CHEBI:16932) |
| UDP-N-acetyl-α-D-muramoyl-L-alanine (CHEBI:84726) is conjugate acid of UDP-N-acetyl-α-D-muramoyl-L-alaninate(3−) (CHEBI:83898) |
| Incoming Relation(s) |
| UDP-N-acetyl-α-D-muramoyl-L-alaninate(3−) (CHEBI:83898) is conjugate base of UDP-N-acetyl-α-D-muramoyl-L-alanine (CHEBI:84726) |
| IUPAC Name |
|---|
| uridine 5'-(3-{2-acetylamino-3-O-[2-(L-alaninocarboxy)ethyl]-2-deoxy-α-D-glucopyranosyl}dihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| UDP-N-acetylmuramoyl-L-alanine | KEGG COMPOUND |
| uridine-5'-diphosphate-N-acetylmuramoyl-L-alanine | ChEBI |