EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27NO3.HCl |
| Net Charge | 0 |
| Average Mass | 377.912 |
| Monoisotopic Mass | 377.17577 |
| SMILES | CCCNCC(O)COc1ccccc1C(=O)CCc1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO3.ClH/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17;/h3-11,18,22-23H,2,12-16H2,1H3;1H |
| InChIKey | XWIHRGFIPXWGEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propafenone hydrochloride (CHEBI:8466) has part propafenone(1+) (CHEBI:63650) |
| propafenone hydrochloride (CHEBI:8466) has role anti-arrhythmia drug (CHEBI:38070) |
| propafenone hydrochloride (CHEBI:8466) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-{2-[2-hydroxy-3-(propylamino)propoxy]phenyl}-3-phenylpropan-1-one hydrochloride |
| Synonyms | Source |
|---|---|
| 2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]-N-propylpropan-1-aminium chloride | IUPAC |
| propafenone HCl | ChemIDplus |
| Propafenon hydrochlorid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Arythmol | ChEBI |
| Rythmol | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4343069 | Reaxys |
| CAS:34183-22-7 | ChemIDplus |
| CAS:34183-22-7 | KEGG DRUG |