EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15ClN5O6PS |
| Net Charge | 0 |
| Average Mass | 471.819 |
| Monoisotopic Mass | 471.01692 |
| SMILES | Nc1ncnc2c1nc(Sc1ccc(Cl)cc1)n2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C16H15ClN5O6PS/c17-7-1-3-8(4-2-7)30-16-21-10-13(18)19-6-20-14(10)22(16)15-11(23)12-9(27-15)5-26-29(24,25)28-12/h1-4,6,9,11-12,15,23H,5H2,(H,24,25)(H2,18,19,20)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | AAZMHPMNAVEBRE-SDBHATRESA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase agonist An agonist that selectively binds to and activates a protein kinase receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-(4-chlorophenylthio)-cAMP (CHEBI:84612) has functional parent 3',5'-cyclic AMP (CHEBI:17489) |
| 8-(4-chlorophenylthio)-cAMP (CHEBI:84612) has role protein kinase agonist (CHEBI:64106) |
| 8-(4-chlorophenylthio)-cAMP (CHEBI:84612) is a 3',5'-cyclic purine nucleotide (CHEBI:19834) |
| 8-(4-chlorophenylthio)-cAMP (CHEBI:84612) is a adenyl ribonucleotide (CHEBI:61296) |
| 8-(4-chlorophenylthio)-cAMP (CHEBI:84612) is a aryl sulfide (CHEBI:35683) |
| 8-(4-chlorophenylthio)-cAMP (CHEBI:84612) is a organochlorine compound (CHEBI:36683) |
| Incoming Relation(s) |
| 8-((4-chlorophenyl)thio)cyclic-3',5'-AMP, monosodium salt (CHEBI:233462) has part 8-(4-chlorophenylthio)-cAMP (CHEBI:84612) |
| IUPAC Name |
|---|
| (4aR,6R,7R,7aS)-6-{6-amino-8-[(4-chlorophenyl)sulfanyl]-9H-purin-9-yl}-2,7-dihydroxytetrahydro-2H,4H-2λ5-furo[3,2-d][1,3,2]dioxaphosphinin-2-one |
| Synonyms | Source |
|---|---|
| 8-CPT-cAMP | ChEBI |
| 8-(4-chlorophenylthio)adenosine cyclic 3',5'-phosphate | ChEBI |
| 8-(4-chlorophenylthio)-3',5'-cyclic AMP | ChEBI |
| 8-(4-chlorophenylthio)-cyclic AMP | ChEBI |
| 8-Parachlorophenylthio camp | ChemIDplus |
| 8-((4-Chlorophenyl)thio)cyclic-3',5'-amp | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:598763 | Reaxys |
| CAS:41941-66-6 | ChemIDplus |
| Citations |
|---|