EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N5O7P |
| Net Charge | 0 |
| Average Mass | 399.300 |
| Monoisotopic Mass | 399.09438 |
| SMILES | CCCC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C14H18N5O7P/c1-2-3-8(20)18-12-9-13(16-5-15-12)19(6-17-9)14-10(21)11-7(25-14)4-24-27(22,23)26-11/h5-7,10-11,14,21H,2-4H2,1H3,(H,22,23)(H,15,16,18,20)/t7-,10-,11-,14-/m1/s1 |
| InChIKey | NVGDLMUKSMHEQT-FRJWGUMJSA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase agonist An agonist that selectively binds to and activates a protein kinase receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-butyryl-cAMP (CHEBI:84605) has functional parent 3',5'-cyclic AMP (CHEBI:17489) |
| N6-butyryl-cAMP (CHEBI:84605) has role protein kinase agonist (CHEBI:64106) |
| N6-butyryl-cAMP (CHEBI:84605) is a 3',5'-cyclic purine nucleotide (CHEBI:19834) |
| N6-butyryl-cAMP (CHEBI:84605) is a adenyl ribonucleotide (CHEBI:61296) |
| N6-butyryl-cAMP (CHEBI:84605) is a butanamides (CHEBI:22965) |
| IUPAC Name |
|---|
| N-{9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxotetrahydro-2H,4H-2λ5-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-9H-purin-6-yl}butanamide |
| Synonyms | Source |
|---|---|
| 6-MB-cAMP | ChEBI |
| N6-butanoyl-cAMP | ChEBI |
| Cyclic N6-monobutyryladenosine-3',5'-monophosphate | ChemIDplus |
| Monobutyryl adnosine cyclic 3',5'-monophosphate | ChemIDplus |
| Monobutyryl cyclic AMP | ChemIDplus |
| N6-Monobutyryl-cAMP | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1054786 | Reaxys |
| CAS:13117-60-7 | ChemIDplus |
| Citations |
|---|