EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2S |
| Net Charge | 0 |
| Average Mass | 284.428 |
| Monoisotopic Mass | 284.13472 |
| SMILES | CN(C)CCCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C17H20N2S/c1-18(2)12-7-13-19-14-8-3-5-10-16(14)20-17-11-6-4-9-15(17)19/h3-6,8-11H,7,12-13H2,1-2H3 |
| InChIKey | ZGUGWUXLJSTTMA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| promazine (CHEBI:8459) has role antiemetic (CHEBI:50919) |
| promazine (CHEBI:8459) has role dopaminergic antagonist (CHEBI:48561) |
| promazine (CHEBI:8459) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| promazine (CHEBI:8459) has role H1-receptor antagonist (CHEBI:37955) |
| promazine (CHEBI:8459) has role muscarinic antagonist (CHEBI:48876) |
| promazine (CHEBI:8459) has role phenothiazine antipsychotic drug (CHEBI:37930) |
| promazine (CHEBI:8459) has role serotonergic antagonist (CHEBI:48279) |
| promazine (CHEBI:8459) is a phenothiazines (CHEBI:38093) |
| promazine (CHEBI:8459) is a tertiary amine (CHEBI:32876) |
| Incoming Relation(s) |
| promazine sulfoxide (CHEBI:145225) has functional parent promazine (CHEBI:8459) |
| promazine hydrochloride (CHEBI:8460) has part promazine (CHEBI:8459) |
| IUPAC Name |
|---|
| N,N-dimethyl-3-(10H-phenothiazin-10-yl)propan-1-amine |
| INNs | Source |
|---|---|
| promazina | ChemIDplus |
| promazine | ChEBI |
| promazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10-(3-(Dimethylamino)propyl)phenothiazine | ChemIDplus |
| N-(3-Dimethylaminopropyl)phenothiazine | ChemIDplus |
| N-Dimethylamino-1-methylethyl thiodiphenylamine | ChemIDplus |
| Promazine | KEGG COMPOUND |
| Citations |
|---|