EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6N2O5 |
| Net Charge | 0 |
| Average Mass | 198.134 |
| Monoisotopic Mass | 198.02767 |
| SMILES | COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N2O5/c1-14-7-3-2-5(8(10)11)4-6(7)9(12)13/h2-4H,1H3 |
| InChIKey | CVYZVNVPQRKDLW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dinitroanisole (CHEBI:84559) has role explosive (CHEBI:63490) |
| 2,4-dinitroanisole (CHEBI:84559) is a dinitroanisoles (CHEBI:84580) |
| IUPAC Name |
|---|
| 1-methoxy-2,4-dinitrobenzene |
| Synonyms | Source |
|---|---|
| 2,4-Dinitrophenylmethyl ether | ChemIDplus |
| Dinitroanisole | ChemIDplus |
| 2,4-Dinitrophenyl methyl ether | ChemIDplus |
| 2,4-Nitroanisole | NIST Chemistry WebBook |
| α-dinitroanisole | NIST Chemistry WebBook |
| 2,4-Dinitro-1-methoxy-benzene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 2,4-dinitroanisole | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17560 | MetaCyc |
| 2,4-Dinitroanisole | Wikipedia |
| Citations |
|---|