EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H76NO8P |
| Net Charge | 0 |
| Average Mass | 742.032 |
| Monoisotopic Mass | 741.53086 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C41H76NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(43)47-37-39(38-49-51(45,46)48-36-35-42)50-41(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h12,14,17-20,39H,3-11,13,15-16,21-38,42H2,1-2H3,(H,45,46)/b14-12-,19-17-,20-18-/t39-/m1/s1 |
| InChIKey | GKAFCSRKMWFPSJ-RJXNKANHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-oleoyl-2-linoleyl-sn-glycero-3-phosphoethanolamine (CHEBI:84543) has functional parent linoleic acid (CHEBI:17351) |
| 1-oleoyl-2-linoleyl-sn-glycero-3-phosphoethanolamine (CHEBI:84543) has functional parent oleic acid (CHEBI:16196) |
| 1-oleoyl-2-linoleyl-sn-glycero-3-phosphoethanolamine (CHEBI:84543) has role mouse metabolite (CHEBI:75771) |
| 1-oleoyl-2-linoleyl-sn-glycero-3-phosphoethanolamine (CHEBI:84543) is a 1,2-diacyl-sn-glycero-3-phosphoethanolamine (CHEBI:64674) |
| 1-oleoyl-2-linoleyl-sn-glycero-3-phosphoethanolamine (CHEBI:84543) is tautomer of 1-oleoyl-2-linoleoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:74977) |
| Incoming Relation(s) |
| 1-oleoyl-2-linoleoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:74977) is tautomer of 1-oleoyl-2-linoleyl-sn-glycero-3-phosphoethanolamine (CHEBI:84543) |
| IUPAC Name |
|---|
| (9Z,21R)-27-amino-24-hydroxy-24-oxido-18-oxo-19,23,25-trioxa-24λ5-phosphaheptacos-9-en-21-yl (9Z,12Z)-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| 1-(9Z-octadecenoyl)-2-(9Z,12Z-octadecadienoyl)-sn-glycero-3-phosphoethanolamine | ChEBI |
| GPEtn(18:1/18:2) | HMDB |
| GPEtn(18:1n9/18:2n6) | HMDB |
| GPEtn(18:1w9/18:2w6) | HMDB |
| PE(18:1(9Z)/18:2(9Z,12Z)) | LIPID MAPS |
| PE(18:1n9/18:2n6) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0009060 | HMDB |
| LMGP02010048 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6796400 | Reaxys |