EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18NO10S2 |
| Net Charge | -1 |
| Average Mass | 388.396 |
| Monoisotopic Mass | 388.03776 |
| SMILES | C=C[C@H](O)CC(=NOS(=O)(=O)[O-])S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO10S2/c1-2-5(14)3-7(12-22-24(18,19)20)23-11-10(17)9(16)8(15)6(4-13)21-11/h2,5-6,8-11,13-17H,1,3-4H2,(H,18,19,20)/p-1/t5-,6+,8+,9-,10+,11-/m0/s1 |
| InChIKey | MYHSVHWQEVDFQT-ILPXZUKPSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| progoitrin(1−) (CHEBI:8454) is a ξ-progoitrin(1−) (CHEBI:47798) |
| progoitrin(1−) (CHEBI:8454) is conjugate base of progoitrin (CHEBI:79352) |
| Incoming Relation(s) |
| (Z)-progoitrin(1−) (CHEBI:183096) is a progoitrin(1−) (CHEBI:8454) |
| progoitrin (CHEBI:79352) is conjugate acid of progoitrin(1−) (CHEBI:8454) |
| IUPAC Name |
|---|
| 1-S-[(3R)-3-hydroxy-N-(sulfonatooxy)pent-4-enimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Progoitrin | KEGG COMPOUND |
| (R)-2-hydroxybut-3-enylglucosinolate | ChEBI |
| (R)-2-hydroxy-3-butenyl glucosinolate | ChemIDplus |