EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3.C4H6O6 |
| Net Charge | 0 |
| Average Mass | 361.354 |
| Monoisotopic Mass | 361.12739 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.c1cnc2cc3c(cc2n1)C1CNCC3C1 |
| InChI | InChI=1S/C13H13N3.C4H6O6/c1-2-16-13-5-11-9-3-8(6-14-7-9)10(11)4-12(13)15-1;5-1(3(7)8)2(6)4(9)10/h1-2,4-5,8-9,14H,3,6-7H2;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | TWYFGYXQSYOKLK-LREBCSMRSA-N |
| Roles Classification |
|---|
| Biological Roles: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| varenicline tartrate (CHEBI:84507) has part varenicline(1+) (CHEBI:84508) |
| varenicline tartrate (CHEBI:84507) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| varenicline tartrate (CHEBI:84507) has role serotonergic agonist (CHEBI:35941) |
| varenicline tartrate (CHEBI:84507) is a tartrate salt (CHEBI:50562) |
| IUPAC Names |
|---|
| 7,8,9,10-tetrahydro-6H-6,10-methanoazepino[4,5-g]quinoxaline (2R,3R)-2,3-dihydroxysuccinic acid |
| 7,8,9,10-tetrahydro-6H-6,10-methanoazepino[4,5-g]quinoxalin-8-ium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate |
| Synonyms | Source |
|---|---|
| CP-526,555-18 | ChemIDplus |
| CP 526555-18 | ChemIDplus |
| 7,8,9,10-Tetrahydro-6,10-methano-6H-pyrazino(2,3-h)(3)benzazepine (2R,3R)-2,3-dihydroxybutanedioate | ChemIDplus |
| varenicline monotartrate | ChEBI |
| Brand Names | Source |
|---|---|
| Chantix | KEGG DRUG |
| Champix | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14347664 | Reaxys |
| CAS:375815-87-5 | KEGG DRUG |
| CAS:375815-87-5 | ChemIDplus |
| Citations |
|---|