EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3 |
| Net Charge | 0 |
| Average Mass | 211.268 |
| Monoisotopic Mass | 211.11095 |
| SMILES | c1cnc2cc3c(cc2n1)[C@@H]1CNC[C@H]3C1 |
| InChI | InChI=1S/C13H13N3/c1-2-16-13-5-11-9-3-8(6-14-7-9)10(11)4-12(13)15-1/h1-2,4-5,8-9,14H,3,6-7H2/t8-,9+ |
| InChIKey | JQSHBVHOMNKWFT-DTORHVGOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| varenicline (CHEBI:84500) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| varenicline (CHEBI:84500) has role serotonergic agonist (CHEBI:35941) |
| varenicline (CHEBI:84500) is a bridged compound (CHEBI:35990) |
| varenicline (CHEBI:84500) is a organic heterotetracyclic compound (CHEBI:38163) |
| varenicline (CHEBI:84500) is a secondary amino compound (CHEBI:50995) |
| varenicline (CHEBI:84500) is conjugate base of varenicline(1+) (CHEBI:84508) |
| Incoming Relation(s) |
| varenicline(1+) (CHEBI:84508) is conjugate acid of varenicline (CHEBI:84500) |
| IUPAC Name |
|---|
| 7,8,9,10-tetrahydro-6H-6,10-methanoazepino[4,5-g]quinoxaline |
| INNs | Source |
|---|---|
| vareniclina | WHO MedNet |
| varenicline | KEGG DRUG |
| varénicline | WHO MedNet |
| vareniclinum | WHO MedNet |
| Synonym | Source |
|---|---|
| 7,8,9,10-Tetrahydro-6,10-methano-6H-pyrazino(2,3-h)(3)benzazepine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2808 | DrugCentral |
| D08669 | KEGG DRUG |
| DB01273 | DrugBank |
| HMDB0015398 | HMDB |
| LSM-5358 | LINCS |
| QMR | PDBeChem |
| Varenicline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10668886 | Reaxys |
| CAS:249296-44-4 | ChemIDplus |
| CAS:249296-44-4 | KEGG DRUG |
| Citations |
|---|