EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H62O3 |
| Net Charge | 0 |
| Average Mass | 614.955 |
| Monoisotopic Mass | 614.46990 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C42H62O3/c1-32(2)15-9-16-33(3)17-10-18-34(4)19-11-20-35(5)21-12-22-36(6)23-13-24-37(7)25-14-26-38(8)27-28-39-31-40(42(44)45)29-30-41(39)43/h15,17,19,21,23,25,27,29-31,43H,9-14,16,18,20,22,24,26,28H2,1-8H3,(H,44,45)/b33-17+,34-19+,35-21+,36-23+,37-25+,38-27+ |
| InChIKey | PEMFGDIFKKXFRG-PYHSYOTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-3-all-trans-heptaprenylbenzoic acid (CHEBI:84494) is a monohydroxybenzoic acid (CHEBI:25389) |
| 4-hydroxy-3-all-trans-heptaprenylbenzoic acid (CHEBI:84494) is a olefinic compound (CHEBI:78840) |
| 4-hydroxy-3-all-trans-heptaprenylbenzoic acid (CHEBI:84494) is conjugate acid of 4-hydroxy-3-all-trans-heptaprenylbenzoate (CHEBI:84496) |
| Incoming Relation(s) |
| 4-hydroxy-3-all-trans-heptaprenylbenzoate (CHEBI:84496) is conjugate base of 4-hydroxy-3-all-trans-heptaprenylbenzoic acid (CHEBI:84494) |
| IUPAC Name |
|---|
| 3-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-1-yl]-4-hydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-9852 | MetaCyc |