EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H70O4 |
| Net Charge | 0 |
| Average Mass | 699.073 |
| Monoisotopic Mass | 698.52741 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1cc(C(=O)O)cc(O)c1O |
| InChI | InChI=1S/C47H70O4/c1-35(2)17-10-18-36(3)19-11-20-37(4)21-12-22-38(5)23-13-24-39(6)25-14-26-40(7)27-15-28-41(8)29-16-30-42(9)31-32-43-33-44(47(50)51)34-45(48)46(43)49/h17,19,21,23,25,27,29,31,33-34,48-49H,10-16,18,20,22,24,26,28,30,32H2,1-9H3,(H,50,51)/b36-19+,37-21+,38-23+,39-25+,40-27+,41-29+,42-31+ |
| InChIKey | ZTGCMYPRIIAXFD-LHSBZCSKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxy-5-all-trans-octaprenylbenzoic acid (CHEBI:84451) is a dihydroxybenzoic acid (CHEBI:23778) |
| 3,4-dihydroxy-5-all-trans-octaprenylbenzoic acid (CHEBI:84451) is conjugate acid of 3,4-dihydroxy-5-all-trans-octaprenylbenzoate (CHEBI:84452) |
| Incoming Relation(s) |
| 3,4-dihydroxy-5-all-trans-octaprenylbenzoate (CHEBI:84452) is conjugate base of 3,4-dihydroxy-5-all-trans-octaprenylbenzoic acid (CHEBI:84451) |
| IUPAC Name |
|---|
| 3,4-dihydroxy-5-[(2E,6E,10E,14E,18E,22E,26E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaen-1-yl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-9894 | MetaCyc |