EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H62O4 |
| Net Charge | 0 |
| Average Mass | 630.954 |
| Monoisotopic Mass | 630.46481 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1cc(C(=O)O)cc(O)c1O |
| InChI | InChI=1S/C42H62O4/c1-31(2)15-9-16-32(3)17-10-18-33(4)19-11-20-34(5)21-12-22-35(6)23-13-24-36(7)25-14-26-37(8)27-28-38-29-39(42(45)46)30-40(43)41(38)44/h15,17,19,21,23,25,27,29-30,43-44H,9-14,16,18,20,22,24,26,28H2,1-8H3,(H,45,46)/b32-17+,33-19+,34-21+,35-23+,36-25+,37-27+ |
| InChIKey | LIEYLSGXGOXYTD-CTBYCIIYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxy-5-all-trans-heptaprenylbenzoic acid (CHEBI:84446) is a dihydroxybenzoic acid (CHEBI:23778) |
| 3,4-dihydroxy-5-all-trans-heptaprenylbenzoic acid (CHEBI:84446) is conjugate acid of 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate (CHEBI:84450) |
| Incoming Relation(s) |
| 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate (CHEBI:84450) is conjugate base of 3,4-dihydroxy-5-all-trans-heptaprenylbenzoic acid (CHEBI:84446) |
| IUPAC Name |
|---|
| 3-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaen-1-yl]-4,5-dihydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-9903 | MetaCyc |