EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18(20)21/h3,7,9,11-12,15,17,19H,2,4-6,8,10,13-14,16H2,1H3,(H,20,21)/b9-7-,11-3-,15-12+/t17-/m0/s1 |
| InChIKey | KLLGGGQNRTVBSU-FQSPHKRJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13(S)-HOTrE (CHEBI:84441) has role mouse metabolite (CHEBI:75771) |
| 13(S)-HOTrE (CHEBI:84441) is a 13-HOTrE (CHEBI:72641) |
| 13(S)-HOTrE (CHEBI:84441) is conjugate acid of 13(S)-HOTrE(1−) (CHEBI:90773) |
| Incoming Relation(s) |
| 13(S)-HOTrE(1−) (CHEBI:90773) is conjugate base of 13(S)-HOTrE (CHEBI:84441) |
| IUPAC Name |
|---|
| (9Z,11E,13S,15Z)-13-hydroxyoctadeca-9,11,15-trienoic acid |
| Synonyms | Source |
|---|---|
| 13(S)-HOTrE | KEGG COMPOUND |
| (9Z,11E,15Z)-(13S)-13-hydroxyoctadeca-9,11,15-trienoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C16316 | KEGG COMPOUND |
| LMFA02000051 | LIPID MAPS |
| T24 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5336126 | Reaxys |
| Citations |
|---|