EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H30O11 |
| Net Charge | 0 |
| Average Mass | 554.548 |
| Monoisotopic Mass | 554.17881 |
| SMILES | COC[C@H]1O[C@@H](Oc2c3c(c(-c4ccc5c(c4)OCO5)c4cc(OC)c(OC)cc24)C(=O)OC3)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C29H30O11/c1-31-12-22-26(34-4)27(35-5)29(39-22)40-25-16-10-20(33-3)19(32-2)9-15(16)23(24-17(25)11-36-28(24)30)14-6-7-18-21(8-14)38-13-37-18/h6-10,22,26-27,29H,11-13H2,1-5H3/t22-,26+,27-,29+/m1/s1 |
| InChIKey | XKNYFHSUBJVWQX-YXPSQANSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cleistanthus collinus (ncbitaxon:1357584) | aerial part (BTO:0001658) | PubMed (14600376) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cleistanthin D (CHEBI:84409) is a cleistanthins (CHEBI:84406) |
| cleistanthin D (CHEBI:84409) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-oxo-1,3-dihydronaphtho[2,3-c]furan-4-yl 2,3,5-tri-O-methyl-β-D-xylofuranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5195451 | Reaxys |
| Citations |
|---|