EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H44N4O6 |
| Net Charge | 0 |
| Average Mass | 616.759 |
| Monoisotopic Mass | 616.32609 |
| SMILES | [H][C@@]1(Cc2cnc3ccccc23)C(=O)N[C@@H](c2ccc(O)cc2)CC(=O)O[C@H](C)[C@H](C)/C=C(\C)C[C@H](C)C(=O)N[C@@H](C)C(=O)N1C |
| InChI | InChI=1S/C35H44N4O6/c1-20-15-21(2)24(5)45-32(41)18-30(25-11-13-27(40)14-12-25)38-34(43)31(17-26-19-36-29-10-8-7-9-28(26)29)39(6)35(44)23(4)37-33(42)22(3)16-20/h7-15,19,21-24,30-31,36,40H,16-18H2,1-6H3,(H,37,42)(H,38,43)/b20-15+/t21-,22+,23+,24-,30-,31-/m1/s1 |
| InChIKey | NCRSWJPOFRASIF-HPUNWYTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondromyces crocatus (ncbitaxon:52) | - | PubMed (8557566) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chondramide C (CHEBI:84382) has role antineoplastic agent (CHEBI:35610) |
| chondramide C (CHEBI:84382) has role bacterial metabolite (CHEBI:76969) |
| chondramide C (CHEBI:84382) is a chondramide (CHEBI:84384) |
| chondramide C (CHEBI:84382) is a indoles (CHEBI:24828) |
| chondramide C (CHEBI:84382) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| chondramide D (CHEBI:84383) has functional parent chondramide C (CHEBI:84382) |
| IUPAC Name |
|---|
| (4R,7R,10S,13S,15E,17R,18R)-4-(4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-8,10,13,15,17,18-hexamethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18855324 | Reaxys |
| Reaxys:7404126 | Reaxys |
| Citations |
|---|