EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H46N4O7 |
| Net Charge | 0 |
| Average Mass | 646.785 |
| Monoisotopic Mass | 646.33665 |
| SMILES | [H][C@@]1(OC)C(=O)O[C@H](C)[C@H](C)/C=C(\C)C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@]([H])(Cc2cnc3ccccc23)C(=O)N[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C36H46N4O7/c1-20-16-21(2)24(5)47-36(45)32(46-7)31(25-12-14-27(41)15-13-25)39-34(43)30(18-26-19-37-29-11-9-8-10-28(26)29)40(6)35(44)23(4)38-33(42)22(3)17-20/h8-16,19,21-24,30-32,37,41H,17-18H2,1-7H3,(H,38,42)(H,39,43)/b20-16+/t21-,22+,23+,24-,30-,31+,32+/m1/s1 |
| InChIKey | IEKCRWAFVYJECW-XYDQKOHOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondromyces crocatus (ncbitaxon:52) | - | PubMed (8557566) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chondramide A (CHEBI:84380) has role antineoplastic agent (CHEBI:35610) |
| chondramide A (CHEBI:84380) has role bacterial metabolite (CHEBI:76969) |
| chondramide A (CHEBI:84380) is a chondramide (CHEBI:84384) |
| chondramide A (CHEBI:84380) is a indoles (CHEBI:24828) |
| chondramide A (CHEBI:84380) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| chondramide B (CHEBI:84381) has functional parent chondramide A (CHEBI:84380) |
| IUPAC Name |
|---|
| (3S,4S,7R,10S,13S,15E,17R,18R)-4-(4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22176305 | Reaxys |
| Citations |
|---|