EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35N3O13 |
| Net Charge | 0 |
| Average Mass | 501.486 |
| Monoisotopic Mass | 501.21699 |
| SMILES | N[C@H]1[C@H](O[C@H]2[C@H](O)[C@@H](N)[C@H](O[C@H]3[C@H](O)[C@@H](N)C(O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H35N3O13/c19-7-12(27)14(5(2-23)30-16(7)29)33-18-9(21)13(28)15(6(3-24)32-18)34-17-8(20)11(26)10(25)4(1-22)31-17/h4-18,22-29H,1-3,19-21H2/t4-,5-,6-,7-,8-,9-,10-,11-,12-,13-,14-,15-,16?,17+,18+/m1/s1 |
| InChIKey | RQFQJYYMBWVMQG-NLJWRWSBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Thalassiosira pseudonana CCMP1335 (ncbitaxon:296543) | - | MetaboLights (MTBLS154) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. eukaryotic metabolite Any metabolite produced during a metabolic reaction in eukaryotes, the taxon that include members of the fungi, plantae and animalia kingdoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chitotriose (CHEBI:84373) has role eukaryotic metabolite (CHEBI:75763) |
| chitotriose (CHEBI:84373) has role marine metabolite (CHEBI:76507) |
| chitotriose (CHEBI:84373) is a amino trisaccharide (CHEBI:59266) |
| IUPAC Name |
|---|
| 2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-2-amino-2-deoxy-D-glucopyranose |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006578 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5486835 | Reaxys |
| Citations |
|---|