EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11O5 |
| Net Charge | -1 |
| Average Mass | 199.182 |
| Monoisotopic Mass | 199.06120 |
| SMILES | O=C([O-])C(=O)C[C@@H]1CC[C@@H](O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C9H12O5/c10-5-2-1-4(7-8(5)14-7)3-6(11)9(12)13/h4-5,7-8,10H,1-3H2,(H,12,13)/p-1/t4-,5+,7+,8-/m0/s1 |
| InChIKey | GDGJNVNXUIMBFT-LAHCRNKXSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (23317005) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]pyruvate (CHEBI:84357) has role bacterial metabolite (CHEBI:76969) |
| 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]pyruvate (CHEBI:84357) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]pyruvate (CHEBI:84357) is conjugate base of 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]pyruvic acid (CHEBI:85359) |
| Incoming Relation(s) |
| 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]pyruvic acid (CHEBI:85359) is conjugate acid of 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]pyruvate (CHEBI:84357) |
| IUPAC Name |
|---|
| 3-[(1R,2S,5R,6S)-5-hydroxy-7-oxabicyclo[4.1.0]heptan-2-yl]-2-oxopropanoate |
| Synonym | Source |
|---|---|
| epoxy-4S-H4HPP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17536 | MetaCyc |
| Citations |
|---|