EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O4S |
| Net Charge | 0 |
| Average Mass | 268.294 |
| Monoisotopic Mass | 268.05178 |
| SMILES | NC(Cc1cc(O)c2c(c1)SCC(=O)N2)C(=O)O |
| InChI | InChI=1S/C11H12N2O4S/c12-6(11(16)17)1-5-2-7(14)10-8(3-5)18-4-9(15)13-10/h2-3,6,14H,1,4,12H2,(H,13,15)(H,16,17) |
| InChIKey | IRQPIGVFKBQNEM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (18435615) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-(2-amino-2-carboxyethyl)-5-hydroxy-3,4-dihydro-2H-1,4-benzothiazin-3-one (CHEBI:84344) has role human metabolite (CHEBI:77746) |
| 7-(2-amino-2-carboxyethyl)-5-hydroxy-3,4-dihydro-2H-1,4-benzothiazin-3-one (CHEBI:84344) is a benzothiazine (CHEBI:46899) |
| 7-(2-amino-2-carboxyethyl)-5-hydroxy-3,4-dihydro-2H-1,4-benzothiazin-3-one (CHEBI:84344) is a lactam (CHEBI:24995) |
| 7-(2-amino-2-carboxyethyl)-5-hydroxy-3,4-dihydro-2H-1,4-benzothiazin-3-one (CHEBI:84344) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 7-(2-amino-2-carboxyethyl)-5-hydroxy-3,4-dihydro-2H-1,4-benzothiazin-3-one (CHEBI:84344) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-(5-hydroxy-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-7-yl)alanine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1626927 | Reaxys |
| Citations |
|---|