EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2O3S |
| Net Charge | 0 |
| Average Mass | 238.268 |
| Monoisotopic Mass | 238.04121 |
| SMILES | NC(Cc1cc(O)c2ncsc2c1)C(=O)O |
| InChI | InChI=1S/C10H10N2O3S/c11-6(10(14)15)1-5-2-7(13)9-8(3-5)16-4-12-9/h2-4,6,13H,1,11H2,(H,14,15) |
| InChIKey | UMUZRISCJNWXTN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (18435615) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(2-amino-2-carboxyethyl)-4-hydroxybenzothiazole (CHEBI:84343) has role human metabolite (CHEBI:77746) |
| 6-(2-amino-2-carboxyethyl)-4-hydroxybenzothiazole (CHEBI:84343) is a benzothiazoles (CHEBI:37947) |
| 6-(2-amino-2-carboxyethyl)-4-hydroxybenzothiazole (CHEBI:84343) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 6-(2-amino-2-carboxyethyl)-4-hydroxybenzothiazole (CHEBI:84343) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 3-(4-hydroxy-1,3-benzothiazol-6-yl)alanine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1582822 | Reaxys |
| Citations |
|---|