EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:84338 - synthalin A
| Formula | C12H28N6 |
| Net Charge | 0 |
| Average Mass | 256.398 |
| Monoisotopic Mass | 256.23754 |
| SMILES | N=C(N)NCCCCCCCCCCNC(=N)N |
| InChI | InChI=1S/C12H28N6/c13-11(14)17-9-7-5-3-1-2-4-6-8-10-18-12(15)16/h1-10H2,(H4,13,14,17)(H4,15,16,18) |
| InChIKey | OZZMUVKANAPKGI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| synthalin A (CHEBI:84338) has parent hydride decane (CHEBI:41808) |
| synthalin A (CHEBI:84338) has role hepatotoxic agent (CHEBI:50908) |
| synthalin A (CHEBI:84338) has role hypoglycemic agent (CHEBI:35526) |
| synthalin A (CHEBI:84338) has role nephrotoxic agent (CHEBI:50909) |
| synthalin A (CHEBI:84338) is a guanidines (CHEBI:24436) |
| synthalin A (CHEBI:84338) is conjugate base of synthalin A(2+) (CHEBI:84339) |
| Incoming Relation(s) |
| synthalin A(2+) (CHEBI:84339) is conjugate acid of synthalin A (CHEBI:84338) |
| IUPAC Name |
|---|
| 1,1'-decane-1,10-diyldiguanidine |
| Synonyms | Source |
|---|---|
| N,N'''-1,10-Decanediylbisguanidine | ChemIDplus |
| decamethylenebis(guanidine) | ChEBI |
| 1,1'-decamethylenediguanidine | ChEBI |
| decamethylenediguanidine | ChEBI |
| 1,10-bis(guanidino)decane | ChEBI |
| Citations |
|---|