EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H28N6.2HCl |
| Net Charge | 0 |
| Average Mass | 329.320 |
| Monoisotopic Mass | 328.19090 |
| SMILES | Cl.Cl.N=C(N)NCCCCCCCCCCNC(=N)N |
| InChI | InChI=1S/C12H28N6.2ClH/c13-11(14)17-9-7-5-3-1-2-4-6-8-10-18-12(15)16;;/h1-10H2,(H4,13,14,17)(H4,15,16,18);2*1H |
| InChIKey | HJJOBGICUREWHC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| synthalin (CHEBI:84333) has part synthalin A(2+) (CHEBI:84339) |
| synthalin (CHEBI:84333) has role hepatotoxic agent (CHEBI:50908) |
| synthalin (CHEBI:84333) has role hypoglycemic agent (CHEBI:35526) |
| synthalin (CHEBI:84333) has role nephrotoxic agent (CHEBI:50909) |
| synthalin (CHEBI:84333) is a guanidinium salt (CHEBI:83635) |
| synthalin (CHEBI:84333) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 1,1'-decane-1,10-diyldiguanidine dihydrochloride |
| (decane-1,10-diyldiimino)bis(iminomethanaminium) dichloride |
| Synonyms | Source |
|---|---|
| 1,10-bis(guanidino)decane dihydrochloride | ChEBI |
| 1,1'-Decamethylenediguanidine dihydrochloride | ChemIDplus |
| Decamethylenediguanidine dihydrochloride | ChemIDplus |
| decamethylenediguanidine hydrochloride | ChEBI |
| Decanediguanidine dihydrochloride | ChemIDplus |
| N,N'''-1,10-Decanediylbisguanadine dihydrochloride | ChemIDplus |
| Citations |
|---|