EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:84328 - (9Z)-heptadecenoic acid
| Formula | C17H32O2 |
| Net Charge | 0 |
| Average Mass | 268.441 |
| Monoisotopic Mass | 268.24023 |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C17H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h8-9H,2-7,10-16H2,1H3,(H,18,19)/b9-8- |
| InChIKey | QSBYPNXLFMSGKH-HJWRWDBZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudozyma flocculosa (ncbitaxon:84751) | - | PubMed (11157268) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z)-heptadecenoic acid (CHEBI:84328) has role antifungal agent (CHEBI:35718) |
| (9Z)-heptadecenoic acid (CHEBI:84328) has role fungal metabolite (CHEBI:76946) |
| (9Z)-heptadecenoic acid (CHEBI:84328) is a heptadecenoic acid (CHEBI:36001) |
| (9Z)-heptadecenoic acid (CHEBI:84328) is a straight-chain fatty acid (CHEBI:59202) |
| (9Z)-heptadecenoic acid (CHEBI:84328) is conjugate acid of (9Z)-heptadecenoate (CHEBI:137434) |
| Incoming Relation(s) |
| 1-palmitoyl-2-(9Z-heptadecenoyl)-sn-glycero-3-phosphocholine (CHEBI:84577) has functional parent (9Z)-heptadecenoic acid (CHEBI:84328) |
| cholesteryl (9Z)-heptadecenoate (CHEBI:84329) has functional parent (9Z)-heptadecenoic acid (CHEBI:84328) |
| (9Z)-heptadecenoate (CHEBI:137434) is conjugate base of (9Z)-heptadecenoic acid (CHEBI:84328) |
| IUPAC Name |
|---|
| (9Z)-heptadec-9-enoic acid |
| Synonym | Source |
|---|---|
| cis-9-heptadecenoic acid | ChEBI |
| Citations |
|---|