EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:84328 - (9Z)-heptadecenoic acid
| Formula | C17H32O2 |
| Net Charge | 0 |
| Average Mass | 268.441 |
| Monoisotopic Mass | 268.24023 |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C17H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h8-9H,2-7,10-16H2,1H3,(H,18,19)/b9-8- |
| InChIKey | QSBYPNXLFMSGKH-HJWRWDBZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudozyma flocculosa (ncbitaxon:84751) | - | PubMed (11157268) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z)-heptadecenoic acid (CHEBI:84328) has role antifungal agent (CHEBI:35718) |
| (9Z)-heptadecenoic acid (CHEBI:84328) has role fungal metabolite (CHEBI:76946) |
| (9Z)-heptadecenoic acid (CHEBI:84328) is a heptadecenoic acid (CHEBI:36001) |
| (9Z)-heptadecenoic acid (CHEBI:84328) is a straight-chain fatty acid (CHEBI:59202) |
| (9Z)-heptadecenoic acid (CHEBI:84328) is conjugate acid of (9Z)-heptadecenoate (CHEBI:137434) |
| Incoming Relation(s) |
| 1-palmitoyl-2-(9Z-heptadecenoyl)-sn-glycero-3-phosphocholine (CHEBI:84577) has functional parent (9Z)-heptadecenoic acid (CHEBI:84328) |
| cholesteryl (9Z)-heptadecenoate (CHEBI:84329) has functional parent (9Z)-heptadecenoic acid (CHEBI:84328) |
| (9Z)-heptadecenoate (CHEBI:137434) is conjugate base of (9Z)-heptadecenoic acid (CHEBI:84328) |
| IUPAC Name |
|---|
| (9Z)-heptadec-9-enoic acid |
| Synonym | Source |
|---|---|
| cis-9-heptadecenoic acid | ChEBI |
| Citations |
|---|