EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO4 |
| Net Charge | 0 |
| Average Mass | 199.206 |
| Monoisotopic Mass | 199.08446 |
| SMILES | [NH3+][C@@H](C[C@@H]1CCC(=O)[C@@H]2O[C@H]12)C(=O)[O-] |
| InChI | InChI=1S/C9H13NO4/c10-5(9(12)13)3-4-1-2-6(11)8-7(4)14-8/h4-5,7-8H,1-3,10H2,(H,12,13)/t4-,5-,7+,8-/m0/s1 |
| InChIKey | KHVZXXWDPSCGEK-MGVQOFIGSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. EC 2.6.1.16 (glutamine--fructose-6-phosphate transaminase (isomerizing)) inhibitor An EC 2.6.1.* (transaminase) inhibitor that interferes with the action of glutamine—fructose-6-phosphate transaminase (isomerizing) (EC 2.6.1.19). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anticapsin zwitterion (CHEBI:84310) has role antimetabolite (CHEBI:35221) |
| anticapsin zwitterion (CHEBI:84310) has role antimicrobial agent (CHEBI:33281) |
| anticapsin zwitterion (CHEBI:84310) has role bacterial metabolite (CHEBI:76969) |
| anticapsin zwitterion (CHEBI:84310) has role EC 2.6.1.16 (glutamine—fructose-6-phosphate transaminase (isomerizing)) inhibitor (CHEBI:85011) |
| anticapsin zwitterion (CHEBI:84310) is a L-α-amino acid zwitterion (CHEBI:59869) |
| anticapsin zwitterion (CHEBI:84310) is tautomer of anticapsin (CHEBI:85005) |
| Incoming Relation(s) |
| anticapsin (CHEBI:85005) is tautomer of anticapsin zwitterion (CHEBI:84310) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-[(1R,2S,6R)-5-oxo-7-oxabicyclo[4.1.0]hept-2-yl]propanoate |
| Synonym | Source |
|---|---|
| L-anticapsin zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-anticapsin | UniProt |
| Citations |
|---|