EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N2O2.HCl |
| Net Charge | 0 |
| Average Mass | 272.776 |
| Monoisotopic Mass | 272.12916 |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C13H20N2O2.ClH/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11;/h5-8H,3-4,9-10,14H2,1-2H3;1H |
| InChIKey | HCBIBCJNVBAKAB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Procaine hydrochloride (CHEBI:8431) has role anti-HIV agent (CHEBI:64946) |
| Procaine hydrochloride (CHEBI:8431) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Anestil | ChEMBL |
| Enpro | ChEMBL |
| Jenacaine | ChEMBL |
| Medaject | ChEMBL |
| Naucaine | ChEMBL |
| Neocaine | ChEMBL |
| Brand Names | Source |
|---|---|
| Gero | ChEMBL |
| Novocain | ChEMBL |
| Pasconeural n | ChEMBL |
| Procaine hydrochloride component of achromycin | ChEMBL |
| Procaine hydrochloride component of cardioplegin | ChEMBL |
| Citations |
|---|