EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N3 |
| Net Charge | 0 |
| Average Mass | 143.234 |
| Monoisotopic Mass | 143.14225 |
| SMILES | CN1CCN(CCN)CC1 |
| InChI | InChI=1S/C7H17N3/c1-9-4-6-10(3-2-8)7-5-9/h2-8H2,1H3 |
| InChIKey | GOWUDHPKGOIDIX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS150) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(4-methyl-1-piperazinyl)ethanamine (CHEBI:84290) has role human metabolite (CHEBI:77746) |
| 2-(4-methyl-1-piperazinyl)ethanamine (CHEBI:84290) is a N-alkylpiperazine (CHEBI:46845) |
| IUPAC Name |
|---|
| 2-(4-methylpiperazin-1-yl)ethanamine |
| Synonym | Source |
|---|---|
| 4-methylpiperazine-1-ethylamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:105097 | Reaxys |
| CAS:934-98-5 | ChemIDplus |
| Citations |
|---|