EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H14N2 |
| Net Charge | 0 |
| Average Mass | 102.181 |
| Monoisotopic Mass | 102.11570 |
| SMILES | CC(C)NCCN |
| InChI | InChI=1S/C5H14N2/c1-5(2)7-4-3-6/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | KDRUIMNNZBMLJR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | MetaboLights (MTBLS152) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-isopropylaminoethylamine (CHEBI:84288) has role human metabolite (CHEBI:77746) |
| 2-isopropylaminoethylamine (CHEBI:84288) is a primary aliphatic amine (CHEBI:17062) |
| 2-isopropylaminoethylamine (CHEBI:84288) is a secondary aliphatic amine (CHEBI:50981) |
| IUPAC Name |
|---|
| N-(propan-2-yl)ethane-1,2-diamine |
| Synonym | Source |
|---|---|
| N-isopropylethylenediamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1732183 | Reaxys |
| CAS:19522-67-9 | ChemIDplus |