EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H42O4 |
| Net Charge | 0 |
| Average Mass | 382.585 |
| Monoisotopic Mass | 382.30831 |
| SMILES | C=CCOC(=O)C(=O)OCCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C23H42O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-27-23(25)22(24)26-20-4-2/h4H,2-3,5-21H2,1H3 |
| InChIKey | JUETYCJINGVUAJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (25518943) | Metabolite observed in cancer metabolism. | |
| - | MetaboLights (MTBLS150) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allyl octadecyl oxalate (CHEBI:84271) has functional parent allyl alcohol (CHEBI:16605) |
| allyl octadecyl oxalate (CHEBI:84271) has functional parent octadecan-1-ol (CHEBI:32154) |
| allyl octadecyl oxalate (CHEBI:84271) has functional parent oxalic acid (CHEBI:16995) |
| allyl octadecyl oxalate (CHEBI:84271) has role human metabolite (CHEBI:77746) |
| allyl octadecyl oxalate (CHEBI:84271) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| allyl octadecyl oxalate (CHEBI:84271) is a diester (CHEBI:51307) |
| IUPAC Name |
|---|
| octadecyl prop-2-en-1-yl ethanedioate |
| Citations |
|---|