EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O2S2 |
| Net Charge | 0 |
| Average Mass | 516.857 |
| Monoisotopic Mass | 516.30957 |
| SMILES | CC(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H48O2S2/c1-27(2,3)21-15-19(16-22(25(21)32)28(4,5)6)34-31(13,14)35-20-17-23(29(7,8)9)26(33)24(18-20)30(10,11)12/h15-18,32-33H,1-14H3 |
| InChIKey | FYPMFJGVHOHGLL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anticholesteremic drug A substance used to lower plasma cholesterol levels. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| probucol (CHEBI:8427) has role anti-inflammatory drug (CHEBI:35472) |
| probucol (CHEBI:8427) has role anticholesteremic drug (CHEBI:35821) |
| probucol (CHEBI:8427) has role antilipemic drug (CHEBI:35679) |
| probucol (CHEBI:8427) has role antioxidant (CHEBI:22586) |
| probucol (CHEBI:8427) has role cardiovascular drug (CHEBI:35554) |
| probucol (CHEBI:8427) is a dithioketal (CHEBI:59800) |
| probucol (CHEBI:8427) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4,4'-(propane-2,2-diyldisulfanediyl)bis(2,6-di-tert-butylphenol) |
| INNs | Source |
|---|---|
| probucol | WHO MedNet |
| probucol | WHO MedNet |
| probucol | WHO MedNet |
| probucolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4,4'- (Isopropylidenedithio)bis(2,6-di-tert-butylphenol) | HMDB |
| Acetone bis(3,5-di-tert-butyl-4-hydroxyphenyl) mercaptole | HMDB |
| Biphenabid | ChemIDplus |
| Bisbid | ChemIDplus |
| Bisphenabid | ChemIDplus |
| DH-581 | ChEBI |
| Brand Names | Source |
|---|---|
| Lesterol | ChemIDplus |
| Lorelco | KEGG DRUG |
| Lurselle | ChEBI |
| Serterol | ChEBI |
| Superlipid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2269 | DrugCentral |
| C07373 | KEGG COMPOUND |
| CN101423484 | Patent |
| CN101455842 | Patent |
| CN102973535 | Patent |
| D00476 | KEGG DRUG |
| DB01599 | DrugBank |
| FR1561853 | Patent |
| HMDB0015537 | HMDB |
| LSM-3617 | LINCS |
| Probucol | Wikipedia |
| US3576883 | Patent |
| US3862332 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2026253 | Reaxys |
| CAS:23288-49-5 | KEGG COMPOUND |
| CAS:23288-49-5 | ChemIDplus |
| Citations |
|---|