EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8426 - probenecid
| Formula | C13H19NO4S |
| Net Charge | 0 |
| Average Mass | 285.365 |
| Monoisotopic Mass | 285.10348 |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-3-9-14(10-4-2)19(17,18)12-7-5-11(6-8-12)13(15)16/h5-8H,3-4,9-10H2,1-2H3,(H,15,16) |
| InChIKey | DBABZHXKTCFAPX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-obesity agent Any substance which is used to reduce or control weight. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. uricosuric drug A gout suppressant that acts directly on the renal tubule to increase the excretion of uric acid, thus reducing its concentrations in plasma. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| probenecid (CHEBI:8426) has role anti-obesity agent (CHEBI:74518) |
| probenecid (CHEBI:8426) has role antibacterial agent (CHEBI:33282) |
| probenecid (CHEBI:8426) has role antiinfective agent (CHEBI:35441) |
| probenecid (CHEBI:8426) has role antineoplastic agent (CHEBI:35610) |
| probenecid (CHEBI:8426) has role antiviral agent (CHEBI:22587) |
| probenecid (CHEBI:8426) has role cardiovascular drug (CHEBI:35554) |
| probenecid (CHEBI:8426) has role gout suppressant (CHEBI:35845) |
| probenecid (CHEBI:8426) has role hypoglycemic agent (CHEBI:35526) |
| probenecid (CHEBI:8426) has role neuroprotective agent (CHEBI:63726) |
| probenecid (CHEBI:8426) has role renoprotective agent (CHEBI:231911) |
| probenecid (CHEBI:8426) has role uricosuric drug (CHEBI:35841) |
| probenecid (CHEBI:8426) is a benzoic acids (CHEBI:22723) |
| probenecid (CHEBI:8426) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-(dipropylsulfamoyl)benzoic acid |
| INNs | Source |
|---|---|
| probenecid | ChemIDplus |
| probenecida | ChemIDplus |
| probenecide | ChemIDplus |
| probenecidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(Di-n-propylsulfamoyl)benzoesäure | ChemIDplus |
| 4-((Dipropylamino)sulfonyl)benzoic acid | ChemIDplus |
| 4-(N,N-Dipropylsulfamoyl)benzoesäure | ChemIDplus |
| HC 5006 | ChEMBL |
| NSC-18786 | ChEMBL |
| p-(Dipropylsulfamoyl)benzoic acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Benemid | ChEMBL |
| Benuryl | ChEMBL |
| Probalan | ChEMBL |
| Probampicin | ChEMBL |
| Probenecid component of col- | ChEMBL |
| Probenecid component of colbenemid | ChEMBL |
| Citations |
|---|