EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO4S |
| Net Charge | 0 |
| Average Mass | 285.365 |
| Monoisotopic Mass | 285.10348 |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-3-9-14(10-4-2)19(17,18)12-7-5-11(6-8-12)13(15)16/h5-8H,3-4,9-10H2,1-2H3,(H,15,16) |
| InChIKey | DBABZHXKTCFAPX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | uricosuric drug A gout suppressant that acts directly on the renal tubule to increase the excretion of uric acid, thus reducing its concentrations in plasma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| probenecid (CHEBI:8426) has role uricosuric drug (CHEBI:35841) |
| probenecid (CHEBI:8426) is a benzoic acids (CHEBI:22723) |
| probenecid (CHEBI:8426) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-(dipropylsulfamoyl)benzoic acid |
| INNs | Source |
|---|---|
| probenecid | ChemIDplus |
| probenecida | ChemIDplus |
| probenecide | ChemIDplus |
| probenecidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(Di-n-propylsulfamoyl)benzoesäure | ChemIDplus |
| 4-((Dipropylamino)sulfonyl)benzoic acid | ChemIDplus |
| 4-(N,N-Dipropylsulfamoyl)benzoesäure | ChemIDplus |
| p-(Dipropylsulfamoyl)benzoic acid | ChemIDplus |
| Probenecid Acid | DrugBank |
| Citations |
|---|