EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13N |
| Net Charge | 0 |
| Average Mass | 87.166 |
| Monoisotopic Mass | 87.10480 |
| SMILES | CCC(N)CC |
| InChI | InChI=1S/C5H13N/c1-3-5(6)4-2/h5H,3-4,6H2,1-2H3 |
| InChIKey | PQPFFKCJENSZKL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (25518943) | Metabolite observed in cancer metabolism. | |
| - | MetaboLights (MTBLS150) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentan-3-amine (CHEBI:84248) has parent hydride pentane (CHEBI:37830) |
| pentan-3-amine (CHEBI:84248) has role human metabolite (CHEBI:77746) |
| pentan-3-amine (CHEBI:84248) is a primary aliphatic amine (CHEBI:17062) |
| IUPAC Name |
|---|
| pentan-3-amine |
| Synonyms | Source |
|---|---|
| 1-ethylpropylamine | ChemIDplus |
| 3-aminopentane | ChEBI |
| 3-pentylamine | ChEBI |
| diethylmethylamine | ChEBI |
| N-(diethylmethyl)amine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:635658 | Reaxys |
| CAS:616-24-0 | ChemIDplus |
| Citations |
|---|