EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H17N |
| Net Charge | 0 |
| Average Mass | 115.220 |
| Monoisotopic Mass | 115.13610 |
| SMILES | CC(C)C(N)C(C)C |
| InChI | InChI=1S/C7H17N/c1-5(2)7(8)6(3)4/h5-7H,8H2,1-4H3 |
| InChIKey | FATQVQVMXNESGD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (25518943) | Metabolite observed in cancer metabolism. | |
| - | MetaboLights (MTBLS150) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dimethylpentan-3-amine (CHEBI:84245) has role human metabolite (CHEBI:77746) |
| 2,4-dimethylpentan-3-amine (CHEBI:84245) is a primary aliphatic amine (CHEBI:17062) |
| IUPAC Name |
|---|
| 2,4-dimethylpentan-3-amine |
| Synonyms | Source |
|---|---|
| 2,4-dimethyl-3-aminopentane | ChEBI |
| diisopropylmethylamine | ChEBI |
| 1-isopropyl-2-methylpropylamine | ChEBI |
| 3-amino-2,4-dimethylpentane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1731599 | Reaxys |
| CAS:4083-57-2 | ChemIDplus |
| Citations |
|---|