EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H32O |
| Net Charge | 0 |
| Average Mass | 228.420 |
| Monoisotopic Mass | 228.24532 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCO |
| InChI | InChI=1S/C15H32O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h13-16H,5-12H2,1-4H3 |
| InChIKey | HDPUXESLSOZSIB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (25518943) | Metabolite observed in cancer metabolism. | |
| - | MetaboLights (MTBLS150) | ||
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7,11-trimethyldodecan-1-ol (CHEBI:84239) has role human metabolite (CHEBI:77746) |
| 3,7,11-trimethyldodecan-1-ol (CHEBI:84239) has role plant metabolite (CHEBI:76924) |
| 3,7,11-trimethyldodecan-1-ol (CHEBI:84239) is a alkyl alcohol (CHEBI:50584) |
| 3,7,11-trimethyldodecan-1-ol (CHEBI:84239) is a medium-chain fatty alcohol (CHEBI:197506) |
| 3,7,11-trimethyldodecan-1-ol (CHEBI:84239) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 3,7,11-trimethyldodecan-1-ol |
| Synonym | Source |
|---|---|
| Hexahydrofarnesol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1700699 | Reaxys |
| CAS:6750-34-1 | ChemIDplus |
| Citations |
|---|